DPhPC [CAS 207131-40-6]

DPhPC is a derivative of phosphatidylcholine (PC) used to synthesize bilayer vesicle phospholipids. DPhPC bilayer membranes do not leak ions in the absence of pores or ion channels, so they are often used to study the activity of ion channels and the regulation of membrane potential. Nanoliposomes (NTG) prepared based on DPhPC can improve the bioavailability of nitric oxide (NO) and have anti-inflammatory effects[1][2][3].

[207131-40-6]

C48H96NO8P

846.25

CC(C)CCCC(C)CCCC(C)CCCC(C)CC(O[C@@H](COP(OCC[N+](C)(C)C)([O-])=O)COC(CC(C)CCCC(C)CCCC(C)CCCC(C)C)=O)=O

Biochemical Assay Reagents; Liposome

99.77

DMSO : 3.57 mg/mL (ultrasonic; warming; heat to 60°C)

-20°C (Powder, protect from light, stored under nitrogen)

Blue Ice

H315, H317, H319, H335, H360

H315, H317, H319, H335, H360