DTCOBG

DTCOBG (dTCO-SNAP) is a SNAP-tag reactive benzylguanine (BG) analogue specifically designed for the specific labeling of immune cells. dTCOBG forms a stable thioether bond through the cysteine at the active site of SNAP-tag and O6-benzylguanine, resulting in a covalent linkage. dTCOBG demonstrates unique advantages in the labeling of macrophages derived from ER-HoxB8: it only labels SNAP-tag + macrophages, with no background signal in the control group. dTCOBG can be used for click chemistry labeling[1].

C24H28N6O5

480.52

O=C(NCC1=CC=C(C=C1)COC2=C3N=CNC3=NC(N)=N2)OC[C@@H]4O[C@H]5[C@H](CC/C([H])=C([H])/CC5)O4

Biochemical Assay Reagents

Room temperature