Ethyl ricinoleate [CAS 55066-53-0]

(R, Z) -Ethyl 12-hydroxyoctadec-9-enoate is a naturally occurring organic compound belonging to the class of fatty acid esters. It is derived from oleic acid, a common unsaturated fatty acid found in various animal and plant sources. (R, Z) -Ethyl 12-hydroxyoctadec-9-enoate contains an ethyl group and a hydroxyl group at specific positions in the fatty acid chain. It has various applications in industry and biomedicine, especially as a precursor for the synthesis of other bioactive compounds. (R, Z) -Ethyl 12-hydroxyoctadec-9-enoate is also used in the formulation of certain types of cosmetic and personal care products, such as skin creams and lotions.

[55066-53-0]

C20H38O3

326.52

CCCCCC[C@@H](O)C/C=C\CCCCCCCC(OCC)=O

Biochemical Assay Reagents

10 mM in DMSO

4°C (Powder, sealed storage, away from moisture)

Room Temperature

H302, H412

H302, H412