FITC-PEG-FA (MW 10000)

FITC-PEG-FA (MW 10000) is a fluorescent dye composed of Folic acid (FA), polyethylene glycol (PEG) and FITC (HY-66019). Fluorescent dye is linked to PEG and Folic acid through a specific chemical reaction to form a molecule with special properties. FITC-PEG-FA (MW 10000) can be used for fluorescent labeling and imaging[1].

OC1=CC=C(C2(C3=CC(C(NCCOCCOCCNC(CCC(C(O)=O)NC(C4=CC=C(NCC5=CN=C(NC(N)=NC6=O)C6=N5)C=C4)=O)=O)=O)=CC=C3C(O2)=O)C(C=CC(O)=C7)=C7O8)C8=C1.[n]

Fluorescent Dye

Room temperature