FITC-PEG-N3 (MW 1000)

FITC-PEG-N3 (MW 1000) is an azide fluorescent dye containing polyethylene glycol (PEG) and FITC. FITC-PEG-N3 (MW 1000) is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.

O=C(C1=CC=C2C(OC3(C2=C1)C4=CC=C(C=C4OC5=C3C=CC(O)=C5)O)=O)NCCOCCN=[N+]=[N-].[n]

Fluorescent Dye

Room temperature