Gal1-β-4GlcNAc1-β-6Gal [CAS 20331-45-7]

Gal1-β-4GlcNAc1-β-6Gal is a class of biochemical reagents used in glycobiology research. Glycobiology studies the structure, synthesis, biology, and evolution of sugars. It involves carbohydrate chemistry, enzymology of glycan formation and degradation, protein-glycan recognition, and the role of glycans in biological systems. This field is closely related to basic research, biomedicine, and biotechnology[1].

[20331-45-7]

C20H35NO16

545.49

OC[C@@H](O[C@H]([C@@H]([C@H]1O)NC(C)=O)OC[C@@H](O)[C@H](O)[C@H](O)[C@@H](O)C=O)[C@H]1O[C@@H]2O[C@@H]([C@@H]([C@@H]([C@H]2O)O)O)CO

Biochemical Assay Reagents

Room temperature