Glucopiericidin A [CAS 108073-65-0]

Glucopiericidin A is a natural piericidin compound obtained from a marine-derived Streptomyces strain. Glucopiericidin A serves as a glucose transporter (GLUT) chemical probe and suppresses glycolysis. Glucopiericidin A inhibits ATP-dependent filopodia protrusion with Piericidin A (PA; HY-114936) and has no effect alone. Glucopiericidin A induces cell apoptosis through reducing the reactive oxygen species (ROS) level by increasing PRDX1 and exhibits potent antitumor efficacy in ACHN mice xenografts[1][2].

[108073-65-0]

C31H47NO9

577.71

COC1=NC(C/C=C(C)/C/C=C/C(C)=C/[C@@H](C)[C@H](/C(C)=C/C)O[C@@H]2O[C@@H]([C@H]([C@@H]([C@H]2O)O)O)CO)=C(C)C(O)=C1OC

ADC Payload; Apoptosis; GLUT

10 mM in DMSO

Room temperature