Gly-Gly-Gly-PEG2-azide [CAS 2222277-20-3]

Gly-Gly-Gly-PEG2-azide is an ADC linker used in the synthesis of antibody-drug conjugates (ADCs) [1]. Gly-Gly-Gly-PEG4-azide is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.

[2222277-20-3]

C12H23N7O5

345.35

[N-]=[N+]=NCCOCCOCCNC(CNC(CNC(CN)=O)=O)=O

ADC Linker

95

DMSO : 50 mg/mL (ultrasonic)

-20°C, 3 years; 4°C, 2 years (Powder)

Room Temperature