GR65630 [CAS 113140-33-3]

GR65630 is a potent and selective 5-hydroxytryptamine (5-HT) type 3 receptor antagonist. GR65630 can be used to study the expression patterns of 5-HT3 receptors in different brain regions and their possible functions in the central nervous system. GR65630 and its radiolabeled form [3H]GR65630 can be used to study the distribution, density and affinity of the receptors[1].

[113140-33-3]

C16H17N3O

267.33

O=C(CCC1=C(C)N=CN1)C2=CN(C)C3=C2C=CC=C3

5-HT Receptor

Room temperature