GW814408X [CAS 886599-05-9]

GW814408X is a kinase chemical genome group (KCGS) compound that inhibits the AURKC kinase involved in cell cycle progression, checkpoint regulation, and cell division. GW814408X exhibits cell line-dependent toxicity, e.g., cytotoxic effects on HeLa cells. GW814408X acts as a protein kinase inhibitor across ATP-dependent and -independent luciferases with potential implications for Fluc reporter assays[1].

[886599-05-9]

C19H16N6O

344.37

COC1=CC(C2=CNC3=C2N=CN=C3N/N=C/C4=CC=NC=C4)=CC=C1

Aurora Kinase

10 mM in DMSO

Room temperature