H-L-Tyr (2-azidoethyl) -OH [CAS 1570523-47-5]

H-L-Tyr (2-azidoethyl) -OH is a unnatural Tyrosine derivative. H-L-Tyr (2-azidoethyl) -OH is a click chemistry reagent containing an azide group[1][2]. It contains an azide group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing alkyne groups. It can also undergo ring strain-promoted alkyne-azide cycloaddition (SPAAC) with molecules containing DBCO or BCN groups.

[1570523-47-5]

C11H14N4O3

250.25

OC([C@@H](N)CC1=CC=C(C=C1)OCCN=[N+]=[N-])=O

ADC Linker

10 mM in DMSO

Room temperature