Herbicide safener-3 [CAS 3029112-55-5]

Herbicide safener-3 is a compound that increases the selectivity of herbicides. Herbicide safener-3 is often used together with herbicides, particularly those that can be harmful to crops. Herbicide safener-3 reduces the negative effects of herbicide on the crop by regulating metabolic differences between the crop and the weed while still allowing the herbicide to be effective on the weed. Herbicide safener-3 can be used in research that improves herbicide application effectiveness and crop safety[1].

[3029112-55-5]

C18H9ClF5N3O2

429.73

O=C(C1=CC(Cl)=NN=C1OC2=CC(C(F)(F)F)=CC=C2)NC3=CC=C(C=C3F)F

Herbicide

Room temperature