HS-PEG5-CH2CH2N3 [CAS 1449390-11-7]

HS-PEG5-CH2CH2N3 is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. HS-PEG5-CH2CH2N3 is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.

[1449390-11-7]

C12H25N3O5S

323.41

SCCOCCOCCOCCOCCOCCN=[N+]=[N-]

PROTAC Linkers

PEG Linkers

10 mM in DMSO

Room temperature