Lenalidomide 4'-PEG1-azide [CAS 2399455-45-7]

Lenalidomide 4'-PEG1-azide (Compound 4g) is a lenalidomide-derived azide. Lenalidomide 4'-PEG1-azide incorporates the Lenalidomide based cereblon ligand and a linker. Lenalidomide 4'-PEG1-azide is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. Strain-promoted alkyne-azide cycloaddition (SPAAC) can also occur with molecules containing DBCO or BCN groups.[1].

[2399455-45-7]

C17H20N6O4

372.38

[N-]=[N+]=NCCOCCNC1=CC=CC2=C1CN(C3C(NC(CC3)=O)=O)C2=O

E3 Ligase Ligand-Linker Conjugates

10 mM in DMSO

Room temperature