Lys-Bradykinin [CAS 342-10-9]

Lys-Bradykinin, a kind of kallidin and bradykinin receptor ligand, can be generated by kininogen protein through enzymatic cleavage by the protease kallikrein. Lys-Bradykinin, also a vasodilator, can widen blood vessels and increase blood flow. ys-Bradykinin stimulates net Na+ influx, and also the DNA synthesis. Lys-Bradykinin involves in vascular regulation, inflammation and pain sensation[1].

[342-10-9]

C56H85N17O12

1188.38

O=C(N[C@@H](CCCNC(N)=N)C(N1[C@@H](CCC1)C(N2[C@@H](CCC2)C(NCC(N[C@@H](CC3=CC=CC=C3)C(N[C@@H](CO)C(N4[C@@H](CCC4)C(N[C@@H](CC5=CC=CC=C5)C(N[C@@H](CCCNC(N)=N)C(O)=O)=O)=O)=O)=O)=O)=O)=O)=O)[C@H](CCCCN)N

Bradykinin Receptor

10 mM in DMSO

Room temperature