Mal-PEG2-bis-PEG3-BCN [CAS 2882973-13-7]

Mal-PEG2-bis-PEG3-BCN is a cleavable 5 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs) [1]. Mal-PEG2-bis-PEG3-BCN is a click chemistry reagent, it contains a BCN group that can undergo strain-promoted alkyne-azide cycloaddition (SPAAC) with molecules containing Azide groups.

[2882973-13-7]

C61H95N7O20

1246.44

[H][C@@]12[C@@](CCC#CCC2)([H])[C@@H]1COC(NCCOCCOCCOCCNC(CCOCC(NC(CCOCCOCCNC(CCN3C(C=CC3=O)=O)=O)=O)COCCC(NCCOCCOCCOCCNC(OC[C@@H]4[C@@]5(CCC#CCC[C@@]54[H])[H])=O)=O)=O)=O

ADC Linker

Cleavable Linker

97.33

DMSO : 100 mg/mL (ultrasonic)

-20°C (Powder, protect from light, stored under nitrogen)

Blue Ice

H302, H315, H319, H335

H302, H315, H319, H335