Methyl 4,6-O- (1-methylethylidene) -α-D-mannopyranoside [CAS 63167-67-9]

Methyl 4,6-O- (1-methylethylidene) -α-D-mannopyranoside is a class of biochemical reagents used in glycobiology research. Glycobiology studies the structure, synthesis, biology, and evolution of sugars. It involves carbohydrate chemistry, enzymology of glycan formation and degradation, protein-glycan recognition, and the role of glycans in biological systems. This field is closely related to basic research, biomedicine, and biotechnology[1].

[63167-67-9]

C10H18O6

234.25

O[C@H]1[C@@]2([H])[C@](COC(C)(O2)C)([H])O[C@@H]([C@H]1O)OC

Biochemical Assay Reagents

Room temperature