MS44

MS44 is a potent aurora kinase B (AURKB PROTAC) degrader (DC50 = 103 nM). MS44 effectively degrades AURKB in a time- and ubiquitin-proteasome system (UPS) -dependent manner and is selective for AURKB over AURKA and AURKC. MS44 effectively inhibits the proliferation in multiple cancer cell lines and potently induces G2/M arrest. MS44 can be used for the study of AURKB-dependent tumors (Pink: Target protein ligand ; Blue: E3 ligand (HY-112078) ; Black: Linker; E3 ligand + Linker (HY-132938) ).

C57H72FN11O8S

1090.31

CC1=C(SC=N1)C2=CC=C(C=C2)[C@@H](NC([C@@H]3C[C@H](CN3C([C@H](C(C)(C)C)NC(CCCCCCCCC(N(CCCOC4=CC5=NC=NC(NC6=NNC(CC(NC7=CC=CC(F)=C7)=O)=C6)=C5C=C4)CCO)=O)=O)=O)O)=O)C

Aurora Kinase; PROTACs

Aurora B; von Hippel-Lindau (VHL)

Room temperature