N- (Azido-PEG4) -biocytin [CAS 2055042-70-9]

N- (Azido-PEG4) -biocytin is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. N- (Azido-PEG4) -biocytin is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.

[2055042-70-9]

C27H47N7O9S

645.77

O=C(O)[C@H](CCCCNC(CCCC[C@@H]1SC[C@]([C@]1([H])N2)([H])NC2=O)=O)NC(CCOCCOCCOCCOCCN=[N+]=[N-])=O

PROTAC Linkers

PEG Linkers

97.37

10 mM in DMSO

-20°C, 3 years; 4°C, 2 years (Powder)

Room Temperature

H302, H315, H319, H335

H302, H315, H319, H335