N- (m-PEG4) -N'- (azide-PEG4) -Cy7 [CAS 2107273-40-3]

N- (m-PEG4) -N'- (azide-PEG4) -Cy7 is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. N- (m-PEG4) -N'- (azide-PEG4) -Cy7 is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.

[2107273-40-3]

C46H66ClN5O8

852.5

COCCOCCOCCOCC[N+]1=C(/C=C/C=C/C=C/C=C2N(CCOCCOCCOCCOCCN=[N+]=[N-])C3=C(C=CC=C3)C/2(C)C)C(C)(C)C4=C1C=CC=C4.[Cl-]

PROTAC Linkers

PEG Linkers

10 mM in DMSO

Room temperature