N-methyl-N'- (azide-PEG3) -Cy3 [CAS 2107273-16-3]

N-methyl-N'- (azide-PEG3) -Cy3 is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. N-methyl-N'- (azide-PEG3) -Cy3 is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.

[2107273-16-3]

C32H42ClN5O3

580.16

CC(C1=C(N/2C)C=CC=C1)(C)C2=C/C=C/C3=[N+](CCOCCOCCOCCN=[N+]=[N-])C4=C(C=CC=C4)C3(C)C.[Cl-]

PROTAC Linkers

PEG Linkers

10 mM in DMSO

Room temperature