N3-L-Cit-OH [CAS 1799421-66-1]

N3-L-Cit-OH is a click chemistry reagent containing an azide group. N3-L-Cit-OH can be used to construct peptidomimetic ADC linkers using Click-chemistry[1]. It contains an azide group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing alkyne groups. It can also undergo ring strain-promoted alkyne-azide cycloaddition (SPAAC) with molecules containing DBCO or BCN groups.

[1799421-66-1]

C6H11N5O3

201.18

NC(NCCC[C@@H](C(O)=O)N=[N+]=[N-])=O

ADC Linker

10 mM in DMSO

Room temperature