N3-PEG8-CH2COOH [CAS 1343472-07-0]

N3-PEG8-CH2COOH is a PEG-based PROTAC linker can be used in the synthesis of PROTACs[1]. N3-PEG8-CH2COOH is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.

[1343472-07-0]

C18H35N3O10

453.48

O=C(O)COCCOCCOCCOCCOCCOCCOCCOCCN=[N+]=[N-]

PROTAC Linkers

PEG Linkers

10 mM in DMSO

Room temperature