N3-TOTA-Suc [CAS 1993176-74-1]

N3-TOTA-Suc is a click chemistry reagent containing an azide group. Click chemistry is a powerful chemical reaction with excellent bioorthogonality features: biocompatible, rapid and highly specific in biological environments[1]. N3-TOTA-Suc is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.

[1993176-74-1]

C14H26N4O6

346.38

[N-]=[N+]=NCCCOCCOCCOCCCNC(CCC(O)=O)=O

ADC Linker

10 mM in DMSO

Room temperature