Neu5GcAc[1Me,478Ac,9N3]-β-SPh [CAS 1195053-25-8]

Neu5GcAc[1Me,478Ac,9N3]-β-SPh is a biochemical reagent that can be used as a biological material or organic compound for life science related research. Neu5GcAc[1Me,478Ac,9N3]-β-SPh is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.

[1195053-25-8]

C26H32N4O12S

624.62

COC([C@]1(O[C@@]([C@@H]([C@H](C1)OC(C)=O)NC(COC(C)=O)=O)([H])[C@H](OC(C)=O)[C@H](OC(C)=O)CN=[N+]=[N-])SC2=CC=CC=C2)=O

Biochemical Assay Reagents

10 mM in DMSO

Room temperature