Nic-15 [CAS 2896739-91-4]

Nic-15 (compound 4n) is an anti-constrictive agent used to antagonize the hypovascularity of pancreatic tumors. The hypovascularity allows cancer cells to adapt to the nutrient-deficient tumor microenvironment and develop drug resistance. Nic-15 can regulate the PI3K/Akt/mTOR pathway and alleviate ER stress induced by Gemcitabine. Nic-15 can significantly inhibit the migration and colony formation of MIA PaCa-2 and PANC-1 pancreatic cancer cells. The combination of Nic-15 and Gemcitabine can effectively solve the problem of pancreatic tumor resistance. In an in vivo xenograft model, Nic-15 can significantly enhance the efficacy of Gemcitabine[1].

[2896739-91-4]

C25H26F2O3

412.47

O=C([C@H]1[C@H](C2=CC=CC(F)=C2F)CC(CC/C=C(C)/C)=CC1)C3=C(O)C=CC=C3O

Akt; mTOR; PI3K

Room temperature