OB-24 (free base) [CAS 940061-39-2]

OB-24 free base is a compound that potently and selectively inhibits heme oxygenase 1 (HO-1) and has the potential to inhibit advanced prostate cancer. OB-24 significantly reduces protein carbonylation and the formation of reactive oxygen species by selectively inhibiting HO-1 activity in prostate cancer cells. OB-24 significantly inhibited cell proliferation in vitro and inhibited tumor growth and lymph node and lung metastasis in vivo. OB-24 exhibits powerful synergy when used in combination with Taxol[1].

[940061-39-2]

C15H17BrN2O2

337.21

BrC1=CC=C(CCC2(CN3C=NC=C3)OCCO2)C=C1

Endogenous Metabolite

Room temperature