PC-Biotin-PEG4-PEG3-azide [CAS 2055198-04-2]

PC-Biotin-PEG4-PEG3-azide is a cleavable 7 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs) [1]. PC-Biotin-PEG4-PEG3-azide is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.

[2055198-04-2]

C39H63N9O14S

914.03

O=C(OC(C1=CC(CNC(CCOCCOCCOCCOCCNC(CCCC[C@@H]2SC[C@]([C@]2([H])N3)([H])NC3=O)=O)=O)=CC=C1[N+]([O-])=O)C)NCCOCCOCCOCCN=[N+]=[N-]

ADC Linker

Cleavable Linker

10 mM in DMSO

Room temperature