Pomalidomide-PEG1-azide [CAS 2133360-04-8]

Pomalidomide-PEG1-azide is a E3 ligase lgand-linker conjugate. Pomalidomide-PEG1-azide incorporates the Pomalidomide based cereblon ligand and a linker. Pomalidomide-PEG1-azide can be used to design a PROTAC BRD4 Degrader-1. Pomalidomide-PEG1-azide is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.

[2133360-04-8]

C17H16N6O6

400.35

O=C(NC1=CC=CC(C(N2C(CC3)C(NC3=O)=O)=O)=C1C2=O)COCCN=[N+]=[N-]

E3 Ligase Ligand-Linker Conjugates

95.03

DMSO : 62.5 mg/mL (ultrasonic; warming; heat to 60°C)

4°C (Powder, protect from light)

Room Temperature

H302, H315, H319, H335

H302, H315, H319, H335