Quinacrine (acetate) [CAS 78901-94-7]

Quinacrine (Acriquine) acetate is a small molecule modulator of the cGAS-STING-TBK1 signaling pathway, possessing immune stimulatory activity. Quinacrine acetate has been explored for its potential therapeutic applications in enhancing anti-tumor immunity. Quinacrine acetate can improve the effectiveness of cancer immunotherapies by addressing the poor immunogenicity of various tumors. Quinacrine acetate also presents a promising strategy for overcoming the limitations associated with immune checkpoint inhibitors in cancer treatment.

[78901-94-7]

C25H34ClN3O3

460.01

O=C(C)O.ClC(C=CC1=C2NC(CCCN(CC)CC)C)=CC1=NC3=C2C=C(OC)C=C3

Apoptosis; DNA Stain; Parasite; Sodium Channel

Room temperature