(R, S, S) -VH032-PEG5-N3 [CAS 2766352-74-1]

(R, S, S) -VH032-PEG5-N3 is an E3 ligase ligand-linker conjugate comprising a VHL ligand based on VH032 and a 5-unit PEG linker. (R, S, S) -VH032-PEG5-N3 is a click chemistry reagent. It contains an azide group and can undergo copper-catalyzed azido-azynylene cycloaddition (CuAAc) with molecules containing an alkyne group. It can also undergo ring-strain-driven alkyne-azido cycloaddition (SPAAC) with molecules containing DBCO or BCN groups.

[2766352-74-1]

C34H51N7O9S

733.88

C([C@@H](NC(COCCOCCOCCOCCOCCN=[N+]=[N-])=O)[C@](C)(C)C)(=O)N1[C@@H](C(NCC2=CC=C(C=C2)C3=C(C)N=CS3)=O)C[C@H](O)C1

E3 Ligase Ligand-Linker Conjugates

Von Hippel-Lindau (VHL)

Room temperature