RB-PEG-N3 (MW 1000)

RB-PEG-N3 (MW 1000) (Rhodamine B-PEG-N3 (MW 1000) ) is a fluorescent dye composed of Rhodamine B , PEG and azide group (N3). RB-PEG-N3 (MW 1000) is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups (Ex/Em = 546/610 nm).

CC/[N+](CC)=C1C=C2OC3=CC(N(CC)CC)=CC=C3C(C4=CC=C(C5=CC=C(C(NCCOCCN=[N+]=[N-])=O)C=C5)C=C4)=C2C=C\1.[Cl-].[n]

Fluorescent Dye

Room temperature