Scrambled 10Panx [CAS 1315378-72-3]

Scrambled 10Panx (FSVYWAQADR) is a random sequence variant of a specific inhibitory peptide 10Panx targeted at the half-channel of Pannexin-1 (Panx1) . Scrambled 10Panx is used as a control peptide to determine whether other experimental conditions or peptides act through specific molecular mechanisms. Scrambled 10Panx can be used for research in neurobiology and cell biology[1].

[1315378-72-3]

C58H79N15O16

1242.34

OC(C=C1)=CC=C1C[C@H](NC([C@H](C(C)C)NC([C@H](CO)NC([C@@H](N)CC2=CC=CC=C2)=O)=O)=O)C(N[C@H](C(N[C@@H](C)C(N[C@@H](CCC(N)=O)C(N[C@@H](C)C(N[C@@H](CC(O)=O)C(N[C@H](C(O)=O)CCCNC(N)=N)=O)=O)=O)=O)=O)CC3=CNC4=CC=CC=C34)=O

Gap Junction Protein

Room temperature