SHP2 protein degrader-3

SHP2 protein degrader-3 is a SHP2 AUTAC degrader. SHP2 protein degrader-3 shows dose-dependent SHP2 degradation ability (DC50 = 3.22 μM) and anti-tumor activity (IC50 = 5.59 μM) in HeLa cells. SHP2 protein degrader-3 induces degradation through the LC3-mediated autophagy pathway, which can be inhibited by lysosome inhibitors. SHP2 protein degrader-3 induces apoptosis in various cancer cells (HeLa cells, HepG2 cells, LoVo cells, Huh-7 cells) (SHP2 Ligand : ; LC3 Ligand: (HY-10542) ; Linker : (HY-128834) ).

C46H51Br2Cl2IN10O7

1213.58

CC1(CCN(CC1)C2=CN=C(C(N)=N2)C3=CC=CC(Cl)=C3Cl)NCC4=CN(CCOCCOCCOCCOCCNC(COC5=C(C=C(C=C5Br)/C=C6C(NC7=C\6C=C(C=C7)I)=O)Br)=O)N=N4

Apoptosis; Atg8/LC3; AUTACs; Autophagy; SHP2

Room temperature