SHY-855 [CAS 2446485-15-8]

SHY-855 is a pan RAS inhibitor. SHY-855 effectively prevents the binding of K-Ras proteins and other members of the Ras superfamily of small GTPases with IC50 values of 0.3-5 μM. SHY-855 effectively inhibits the phosphorylation of MEK, ERK1/2, and AKT downstream of K-Ras. SHY-855 inhibits the formation of the Ras-GTP activity complex. SHY-855 can be used to the studies of pancreatic cancer and non-small cell lung cancer[1].

[2446485-15-8]

C26H24ClN5O2S

506.02

COCCNC1=NC(C2=NC=CN2C)=NC3=C1C(C4=CC=CC=C4)=C(S3)C5=C(C(OC)=CC=C5)Cl

Akt; ERK; MEK; Ras

Akt; ERK1; ERK2; K-Ras; MEK

Room temperature