Silybin B-d3

Silybin B-d3 (Silibinin B-d3) is a deuterated Silybin B. Silybin B (Silibinin B) is an orally active amyloid-β aggregation inhibitor and ATR pathway activator, that can cross the blood-brain barrier. Silybin B inhibits Aβ fibril formation and promotes amorphous aggregate formation, while activating the ATR-mediated DNA damage repair pathway and inhibiting JNK/p38 MAPK signaling. Silybin B can reduce Cisplatin (HY-17394) -induced neuronal DNA damage and apoptosis. Silybin B has anti-oxidative stress, cell cycle regulation and neuroprotective activities. Silybin B is mainly used in the study of Alzheimer's disease and Cisplatin chemotherapy-related neurotoxicity[1][2][3][4].

C25H19D3O10

485.45

O=C1[C@H](O)[C@@H](C2=CC=C(O[C@@H](CO)[C@H](C3=CC=C(O)C(OC([2H])([2H])[2H])=C3)O4)C4=C2)OC5=CC(O)=CC(O)=C15

Amyloid-β; Apoptosis; Isotope-Labeled Compounds; JNK; p38 MAPK

Room temperature