Sulfathiazole (100 µg/mL in acetonitrile) [CAS 72-14-0]

Sulfathiazole (100 μg/mL in acetonitrile) is an orally active, endocrine disruptor targeting the steroidogenic pathway, specifically enhancing the activity of CYP19 in human adrenal cancer cells (H295R) and upregulating the mRN expression of CYP17, CYP19, and 3β-HSD. Sulfathiazole (100 μg/mL in acetonitrile) increases the production of 17-estradiol (E2) and has endocrine disrupting effects on aquatic organisms such as the Japanese medaka fish. Sulfathiazole (100 μg/mL in acetonitrile) is also a cathodic corrosion inhibitor. Sulfathiazole (100 μg/mL in acetonitrile) inhibits the corrosion of copper by chloride ions through chemical and physical adsorption on the copper surface, reduces the corrosion current density and shifts the corrosion potential negatively[1][2][3].

[72-14-0]

C9H9N3O2S2

255.32

O=S(NC1=NC=CS1)(C2=CC=C(C=C2)N)=O

Antibiotic; Bacterial

Room temperature

H302-H315-H319-H335

P261-P264-P270-P271-P280-P302+P352-P304+P340-P305+P351+P338-P330-P362+P364-P403+P233-P405-P501