Sulfo-Cy3-PEG3-biotin (potassium)

Sulfo-Cy3-PEG3-biotin potassium is a biotin-modified derivative of Cy3 (Cyanine3) dye containing a TCO group. The TCO group of Sulfo-Cy3-PEG3-biotin potassium reacts with the tetrazine functional group in highly specific click chemistry to form a covalent bond. Thus, Sulfo-Cy3-PEG3-biotin potassium can be covalently bound to some biomolecules (especially antibodies, proteins, etc.) to track their location and dynamic changes in biological samples. And because it is labeled with biotin, it is often used in affinity chromatography experiments, such as immunoprecipitation.

C46H63KN6O11S3

1011.32

O=C(NCCOCCOCCNC(CCCC[C@@H]1SC[C@]([H])(N2)[C@@]1(NC2=O)[H])=O)CCCCC[N+]3=C(C(C)(C4=C3C=CC(S(=O)([O-])=O)=C4)C)/C=C/C=C5N(C6=CC=C(C=C6C\5(C)C)S(=O)(O[K])=O)C

Fluorescent Dye

10 mM in DMSO

Room temperature