Sulfo-Cy5.5 Azide [CAS 1955527-41-9]

Sulfo-Cy5.5 Azide is a click chemistry reagent containing an azide group. Sulfo-Cy5.5 Azide is also a water-soluble dye (Ex=673 nm, Em=707 nm), which designed to label sensitive molecules such as peptides, proteins and oligonucleotides. It contains an azide group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing alkyne groups. It can also undergo ring strain-promoted alkyne-azide cycloaddition (SPAAC) with molecules containing DBCO or BCN groups.

[1955527-41-9]

C44H50N6O13S4

999.16

O=C(CCCCC[N+]1=C(/C=C/C=C/C=C2N(CC)C3=C(C/2(C)C)C(C=C(S(=O)(O)=O)C=C4S(=O)(O)=O)=C4C=C3)C(C)(C)C5=C(C=C(S(=O)([O-])=O)C=C6S(=O)(O)=O)C6=CC=C15)NCCCN=[N+]=[N-]

Fluorescent Dye

95

DMSO : 50 mg/mL (ultrasonic; warming; heat to 60°C)

-20°C (Powder, protect from light)

Blue Ice