Sulfo-Cy7.5 azide

Sulfo-Cy7.5 azide is a Cyanine 7.5 (Cy7.5) dye derivative with azide and sulfonate functional groups. The sulfonate ion increases the water solubility of the compound, making it suitable for use in aqueous solutions. Cy7.5 is a near-infrared fluorescent dye commonly used for biolabeling and cell imaging. The azide group of Sulfo-Cy7.5 azide can react chemically with molecules containing alkyne functionality, such as alkyne or cyclooctyne, to form covalent bonds. Therefore, Sulfo-Cy7.5 azide can bind to biomolecules such as proteins and antibodies to track their location and dynamic changes in biological samples. It contains an azide group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing alkyne groups. It can also undergo ring strain-promoted alkyne-azide cycloaddition (SPAAC) with molecules containing DBCO or BCN groups.

C48H51K3N6O13S4

1165.51

CN(/C(C1(C)C)=C/C=C2CCCC(/C=C/C3=[N+](CCCCCC(NCCCN=[N+]=[N-])=O)C(C=CC4=C5C=C(S(=O)(O[K])=O)C=C4S([O-])(=O)=O)=C5C3(C)C)=C\2)C6=C1C(C=C(S(=O)(O[K])=O)C=C7S(=O)(O[K])=O)=C7C=C6

Fluorescent Dye

10 mM in DMSO

Room temperature