TASIN-1 [CAS 792927-06-1]

TASIN-1 is a selective inhibitor of truncated APCTR (adenomatous polyposis coli gene) that exerts cytotoxic effects by inhibiting cholesterol biosynthesis. TASIN-1 specifically targets colorectal cancer (CRC) cells carrying APC truncated mutations, while having no significant toxicity to wild-type APC cells. TASIN-1 exerts cytotoxic effects by targeting Emopamil binding protein (EBP) to inhibit cholesterol biosynthesis, triggering endoplasmic reticulum (ER) stress, reactive oxygen species (ROS) generation, and JNK-mediated apoptosis, and inhibiting Akt survival signaling. TASIN-1 can be used to prevent and intervene in APC mutant colorectal cancer[1][2][3].

[792927-06-1]

C18H28N2O3S

352.49

CC1CCN(C2CCN(S(=O)(C3=CC=C(OC)C=C3)=O)CC2)CC1

Apoptosis; Caspase; JNK; Reactive Oxygen Species (ROS)

Caspase 3; Caspase 7

10mM

98.09

DMSO : 25 mg/mL (ultrasonic; warming; heat to 60°C)

-20°C, 3 years; 4°C, 2 years (Powder)

Room Temperature