Tazarotene-d6 [CAS 1246815-76-8]

Tazarotene-d6 (AGN 190168-d6) is deuterium labeled Tazarotene. Tazarotene (AGN 190168) is a selective retinoic acid receptor (RAR) agonist for the treatment of plaque psoriasis and acne vulgaris. Tazarotene is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups.

[1246815-76-8]

C21H15D6NO2S

357.5

[2H]C([2H])([2H])C1(C2=CC(C#CC3=CC=C(C=N3)C(OCC)=O)=CC=C2SCC1)C([2H])([2H])[2H]

Isotope-Labeled Compounds

Room temperature