Temporin-SHa [CAS 1065010-73-2]

Temporin-Sha is an antibacterial peptide with extensive biological activity. Temporin-Sha exhibits broad-spectrum antibacterial activity (e.g., against L. ivanovii, MIC = 6.25 μM), and is effective against Gram-negative bacteria (such as Escherichia coli, MIC = 10 μM), including drug-resistant strains (such as Methicillin -resistant Staphylococcus aureus). Temporin-Sha also has inhibitory effects on Candida albicans (MIC = 25 μM), Saccharomyces cerevisiae (MIC = 12 μM), the pre-flagellated and non-flagellated forms of Leishmania infantum (IC50 = 5-20 μM), and Trypanosoma cruzi (IC50 = 17 μM). Temporin-Sha exhibits antiviral activity against HSV-1 and has anti-cancer effects (cytotoxicity against breast cancer cells MCF-7 and lung cancer cells H460, etc.)[2][3][4][5].

[1065010-73-2]

C67H109N15O14S

1380.74

O=C(N[C@@H](CC(C)C)C(N[C@@H](CO)C(NCC(N[C@@H]([C@@H](C)CC)C(N[C@@H](C(C)C)C(NCC(N[C@@H](CCSC)C(N[C@@H](CC(C)C)C(NCC(N[C@@H](CCCCN)C(N[C@@H](CC(C)C)C(N[C@@H](CC1=CC=CC=C1)C(N)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)[C@H](CC2=CC=CC=C2)N

Bacterial; Fungal; HIV; Parasite

HIV-1

Room temperature