Tetrazolium violet [CAS 1719-71-7]

Tetrazolium violet is a redox indicator commonly used in various biochemical assays to measure cell viability and metabolic activity. Tetrazolium Violet has unique chemical properties that allow it to be reduced by cellular enzymes such as dehydrogenases to form a purple formazan product that can be detected spectrophotometrically. This makes it a useful tool for assessing cell health and growth in culture or tissue samples.

[1719-71-7]

C23H17ClN4

384.86

C1(C2=CC=CC=C2)=NN(C3=CC=CC=C3)[N+](C4=C5C=CC=CC5=CC=C4)=N1.[Cl-]

Biochemical Assay Reagents

99.68

DMSO : 50 mg/mL (ultrasonic; warming; heat to 60°C)

RT, sealed storage, away from moisture and light

Room Temperature

H302, H315, H319, H335

H302, H315, H319, H335