Thalidomide 4'-ether-PEG2-azide [CAS 2758431-90-0]

Thalidomide 4'-ether-PEG2-azide is a click chemistry modified cereblon (CRBN) inhibitor Thalidomide. Thalidomide 4'-ether-PEG2-azide contains an azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing alkynyl groups. Thalidomide 4'-ether-PEG2-azide can be used as a ligand of E3 ubiquitin ligase and Linker conjugates (E3 Ligase Ligand-Linker Conjugates) for the synthesis of PROTACs[1].

[2758431-90-0]

C19H21N5O7

431.4

[N-]=[N+]=NCCOCCOCCOC1=CC=CC(C(N2C3C(NC(CC3)=O)=O)=O)=C1C2=O

Apoptosis; Autophagy; E3 Ligase Ligand-Linker Conjugates

Cereblon

10 mM in DMSO

Room temperature