TMRM Perchlorate (solution) [CAS 115532-50-8]

Rhodamine dyes are membrane-permeable cationic fluorescent probes that specifically recognize mitochondrial membrane potentials, thereby attaching to mitochondria and producing bright fluorescence, and at certain concentrations, rhodamine dyes have low toxicity to cells, so they are commonly used to detect mitochondria in animal cells, plant cells, and microorganisms[1].Solvent and concentration: DMSO: 10 mM

[115532-50-8]

C25H25ClN2O7

500.93

O=C(C1=CC=CC=C1C2=C3C=CC(N(C)C)=CC3=[O+]C4=C2C=CC(N(C)C)=C4)OC.O=Cl(=O)([O-])=O

Fluorescent Dye

Store at -20°C for 1 year, protect from light. Avoid repeated freezing and thawing

Blue Ice