Tri-GalNAc (OAc) 3 [CAS 1159408-64-6]

Tri-GalNAc (OAc) 3is a trivalent N-acetylgalactosamine (GalNAc) derivative that can be used to synthesize GalNAc-LYTAC. Tri-GalNAc is a specific ligand targeting the asialoglycoprotein receptor (ASGPR), mediating the endocytosis and transport of cell surface proteins (such as EGFR, HER2) to lysosomes for degradation by lysosomal targeting chimeras (LYTACs) . Tri-GalNAc significantly reduces the level of target proteins and inhibits downstream signaling pathways (such as EGFR-mediated Akt and MAPK signals) . Tri-GalNAc (OAc) 3can be used for hepatocyte targeting studies, and can degrade carcinogenic membrane proteins and inhibit tumor cell proliferation in liver cancer cell models[1].

[1159408-64-6]

C79H128N10O36

1793.91

CC(O[C@@H]1[C@H]([C@@H](O[C@@H]([C@@H]1OC(C)=O)COC(C)=O)OCCCCC(NCCCNC(CCOCC(COCCC(NCCCNC(CCCCO[C@H]2[C@@H]([C@H]([C@H]([C@H](O2)COC(C)=O)OC(C)=O)OC(C)=O)NC(C)=O)=O)=O)(N)COCCC(NCCCNC(CCCCO[C@H]3[C@@H]([C@H]([C@H]([C@H](O3)COC(C)=O)OC(C)=O)OC(C)=O)NC(C)=O)=O)=O)=O)=O)NC(C)=O)=O

LYTACs

98.09

DMSO : 10 mg/mL (ultrasonic)

-20°C, 3 years; 4°C, 2 years (Powder)

Room Temperature