UPG-108 [CAS 3090686-88-4]

UPG-108, a peptide compound, is a non-competitive allosteric modulator of Urotensin II receptors (UTR) . UPG-108 significantly enhances the efficacy of UTR agonists but reduces the potency of UTR agonists. UPG-111 efficiently induces calcium release and does not cause contraction of rat aortic rings without endothelial denudation. UPG-111 can be used to study various diseases related to the angiotensinergic system[1].

[3090686-88-4]

C65H88N14O17S2

1401.61

O=C([C@@H](NC([C@H](C(C)(SSC[C@H](NC([C@@H](NC([C@@H](NC1=O)CCCN)=O)CC2=CC=C(C=C2)O)=O)C(N[C@H](C(O)=O)C(C)C)=O)C)NC([C@H](CC(O)=O)NC([C@H]3N(CCC3)C([C@H]([C@H](O)C)NC([C@@H](N)CCC(N)=O)=O)=O)=O)=O)=O)CC4=CC=CC=C4)N[C@@H]1CC5=CNC6=CC=CC=C56

Urotensin Receptor

Room temperature