VVD-699 [CAS 3055319-82-6]

VVD-699 is a covalent RAS-PI3K inhibitor. VVD-699 covalently binds to cysteine 242 in the RAS binding domain of PI3K p110α, thereby blocking the ability of RAS to activate PI3K activity. VVD-699 is able to inhibit the growth of RAS-mutated and HER2-overexpressing tumors. VVD-699 can be used to study cancers associated with RAS mutations (e.g., H358 lung cancer cells, A549 cells, FaDu cells) [1].

[3055319-82-6]

C25H30ClFN2O6S2

573.1

COC1=CC(C2=C(Cl)C=CC=C2)=C(S(N3CC[C@](C(N[C@@H](/C=C\S(C)(=O)=O)C)=O)(F)C[C@H]3C)(=O)=O)C=C1

PI3K; Ras

Room temperature