WRN-IN-20 [CAS 3095277-20-3]

WRN inhibitor 20 (Compound 14c) is a WRN degradation agent. WRN inhibitor 20 exhibits strong degradation activity in various cells, such as HCT-116 (DC50 = 1.7 µM), SW-48 (DC50 = 3.0 µM), and SW-480 (DC50 = 5.9 µM) cells. WRN inhibitor 20 exhibits potent anti proliferative, pro apoptotic, migration inhibiting, and DNA damage inducing effects in MSI-H cells. WRN inhibitor 20 can be used for research on cancer[1].

[3095277-20-3]

C37H44F3N5O5S

727.84

O=C(NCCCCCOC1=CC=C(C2=NC(S(=O)(NCC(NC3=CC=C(C)C=C3)=O)=O)=NC(C(F)(F)F)=C2)C=C1)CC45C[C@H](C6)C[C@@H](C5)C[C@H]6C4

Apoptosis; DNA/RNA Synthesis

Room temperature